C14H14F3NO2 — CID 60999159
3-ethyl-2-methyl-6-(2,2,2-trifluoroethoxy)-1H-quinolin-4-one (PubChem CID 60999159) has the molecular formula C14H14F3NO2 and a molecular weight of 285.27 g/mol. Its IUPAC name is 3-ethyl-2-methyl-6-(2,2,2-trifluoroethoxy)-1H-quinolin-4-one.
| Compound Name | 3-ethyl-2-methyl-6-(2,2,2-trifluoroethoxy)-1H-quinolin-4-one |
|---|---|
| PubChem CID | 60999159 |
| Molecular Formula | C14H14F3NO2 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 3-ethyl-2-methyl-6-(2,2,2-trifluoroethoxy)-1H-quinolin-4-one |
| SMILES | CCc1c(C)[nH]c2ccc(OCC(F)(F)F)cc2c1=O |
| InChI | InChI=1S/C14H14F3NO2/c1-3-10-8(2)18-12-5-4-9(6-11(12)13(10)19)20-7-14(15,16)17/h4-6H,3,7H2,1-2H3,(H,18,19) |
| InChIKey | OBLCYSFWIRLAJX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |