C15H14F3NO3 — CID 70376899
2-methyl-3-prop-2-enoxy-7-(2,2,2-trifluoroethoxy)-1H-quinolin-4-one (PubChem CID 70376899) has the molecular formula C15H14F3NO3 and a molecular weight of 313.28 g/mol. Its IUPAC name is 2-methyl-3-prop-2-enoxy-7-(2,2,2-trifluoroethoxy)-1H-quinolin-4-one.
| Compound Name | 2-methyl-3-prop-2-enoxy-7-(2,2,2-trifluoroethoxy)-1H-quinolin-4-one |
|---|---|
| PubChem CID | 70376899 |
| Molecular Formula | C15H14F3NO3 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 2-methyl-3-prop-2-enoxy-7-(2,2,2-trifluoroethoxy)-1H-quinolin-4-one |
| SMILES | C=CCOc1c(C)[nH]c2cc(OCC(F)(F)F)ccc2c1=O |
| InChI | InChI=1S/C15H14F3NO3/c1-3-6-21-14-9(2)19-12-7-10(22-8-15(16,17)18)4-5-11(12)13(14)20/h3-5,7H,1,6,8H2,2H3,(H,19,20) |
| InChIKey | JDXUUBLEVCOAKA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|