C18H23F3N2O — CID 167499874
N-[2-(5-ethoxy-2-methyl-1H-indol-3-yl)ethyl]-N-(2,2,2-trifluoroethyl)prop-2-en-1-amine (PubChem CID 167499874) has the molecular formula C18H23F3N2O and a molecular weight of 340.39 g/mol. Its IUPAC name is N-[2-(5-ethoxy-2-methyl-1H-indol-3-yl)ethyl]-N-(2,2,2-trifluoroethyl)prop-2-en-1-amine.
| Compound Name | N-[2-(5-ethoxy-2-methyl-1H-indol-3-yl)ethyl]-N-(2,2,2-trifluoroethyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 167499874 |
| Molecular Formula | C18H23F3N2O |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | N-[2-(5-ethoxy-2-methyl-1H-indol-3-yl)ethyl]-N-(2,2,2-trifluoroethyl)prop-2-en-1-amine |
| SMILES | C=CCN(CCc1c(C)[nH]c2ccc(OCC)cc12)CC(F)(F)F |
| InChI | InChI=1S/C18H23F3N2O/c1-4-9-23(12-18(19,20)21)10-8-15-13(3)22-17-7-6-14(24-5-2)11-16(15)17/h4,6-7,11,22H,1,5,8-10,12H2,2-3H3 |
| InChIKey | OEKVJWWCGCHCOR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|