C12H10F3NO4S — CID 67946471
2-methyl-3-methylsulfonyl-7-(trifluoromethoxy)-1H-quinolin-4-one (PubChem CID 67946471) has the molecular formula C12H10F3NO4S and a molecular weight of 321.28 g/mol. Its IUPAC name is 2-methyl-3-methylsulfonyl-7-(trifluoromethoxy)-1H-quinolin-4-one.
| Compound Name | 2-methyl-3-methylsulfonyl-7-(trifluoromethoxy)-1H-quinolin-4-one |
|---|---|
| PubChem CID | 67946471 |
| Molecular Formula | C12H10F3NO4S |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 2-methyl-3-methylsulfonyl-7-(trifluoromethoxy)-1H-quinolin-4-one |
| SMILES | Cc1[nH]c2cc(OC(F)(F)F)ccc2c(=O)c1S(C)(=O)=O |
| InChI | InChI=1S/C12H10F3NO4S/c1-6-11(21(2,18)19)10(17)8-4-3-7(5-9(8)16-6)20-12(13,14)15/h3-5H,1-2H3,(H,16,17) |
| InChIKey | FNNAJMBXADEGJY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |