C11H8F3NO5S — CID 151911320
[4-oxo-7-(trifluoromethoxy)-1H-quinolin-3-yl]methanesulfonic acid (PubChem CID 151911320) has the molecular formula C11H8F3NO5S and a molecular weight of 323.25 g/mol. Its IUPAC name is [4-oxo-7-(trifluoromethoxy)-1H-quinolin-3-yl]methanesulfonic acid.
| Compound Name | [4-oxo-7-(trifluoromethoxy)-1H-quinolin-3-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 151911320 |
| Molecular Formula | C11H8F3NO5S |
| Molecular Weight | 323.25 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | [4-oxo-7-(trifluoromethoxy)-1H-quinolin-3-yl]methanesulfonic acid |
| SMILES | O=c1c(CS(=O)(=O)O)c[nH]c2cc(OC(F)(F)F)ccc12 |
| InChI | InChI=1S/C11H8F3NO5S/c12-11(13,14)20-7-1-2-8-9(3-7)15-4-6(10(8)16)5-21(17,18)19/h1-4H,5H2,(H,15,16)(H,17,18,19) |
| InChIKey | SUVFARKNVBZMNJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 96.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|