About barium(2+);1H-indol-3-ylmethanesulfonic acid
barium(2+);1H-indol-3-ylmethanesulfonic acid (PubChem CID 54605499) has the molecular formula C9H9BaNO3S+2
and a molecular weight of 348.57 g/mol. Its IUPAC name is barium(2+);1H-indol-3-ylmethanesulfonic acid.
Molecular Properties
| Compound Name | barium(2+);1H-indol-3-ylmethanesulfonic acid |
| PubChem CID | 54605499 |
| Molecular Formula | C9H9BaNO3S+2 |
| Molecular Weight | 348.57 g/mol |
| Exact Mass | 348.93 |
| IUPAC Name | barium(2+);1H-indol-3-ylmethanesulfonic acid |
| SMILES | O=S(=O)(O)Cc1c[nH]c2ccccc12.[Ba+2] |
| InChI | InChI=1S/C9H9NO3S.Ba/c11-14(12,13)6-7-5-10-9-4-2-1-3-8(7)9;/h1-5,10H,6H2,(H,11,12,13);/q;+2 |
| InChIKey | KZQNHBHRRSYUCW-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.57 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);1H-indol-3-ylmethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);1H-indol-3-ylmethanesulfonic acid?
The IUPAC name of barium(2+);1H-indol-3-ylmethanesulfonic acid (CID 54605499) is barium(2+);1H-indol-3-ylmethanesulfonic acid.
What is the SMILES notation for barium(2+);1H-indol-3-ylmethanesulfonic acid?
The canonical SMILES for barium(2+);1H-indol-3-ylmethanesulfonic acid is O=S(=O)(O)Cc1c[nH]c2ccccc12.[Ba+2].
What is the InChIKey of barium(2+);1H-indol-3-ylmethanesulfonic acid?
The InChIKey is KZQNHBHRRSYUCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO3S.Ba/c11-14(12,13)6-7-5-10-9-4-2-1-3-8(7)9;/h1-5,10H,6H2,(H,11,12,13);/q;+2.
What are the key properties of barium(2+);1H-indol-3-ylmethanesulfonic acid?
barium(2+);1H-indol-3-ylmethanesulfonic acid has a molecular weight of 348.57 g/mol, XLogP of 1.17, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);1H-indol-3-ylmethanesulfonic acid is sourced from PubChem (CID 54605499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).