C22H19F3N2O3 — CID 67012190
2-[6-[5-[4-(trifluoromethoxy)phenyl]pent-4-ynylamino]-1H-indol-3-yl]acetic acid (PubChem CID 67012190) has the molecular formula C22H19F3N2O3 and a molecular weight of 416.40 g/mol. Its IUPAC name is 2-[6-[5-[4-(trifluoromethoxy)phenyl]pent-4-ynylamino]-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[6-[5-[4-(trifluoromethoxy)phenyl]pent-4-ynylamino]-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 67012190 |
| Molecular Formula | C22H19F3N2O3 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 2-[6-[5-[4-(trifluoromethoxy)phenyl]pent-4-ynylamino]-1H-indol-3-yl]acetic acid |
| SMILES | O=C(O)Cc1c[nH]c2cc(NCCCC#Cc3ccc(OC(F)(F)F)cc3)ccc12 |
| InChI | InChI=1S/C22H19F3N2O3/c23-22(24,25)30-18-8-5-15(6-9-18)4-2-1-3-11-26-17-7-10-19-16(12-21(28)29)14-27-20(19)13-17/h5-10,13-14,26-27H,1,3,11-12H2,(H,28,29) |
| InChIKey | UNLBCHONTVWNAD-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|