C17H15ClF3N3O — CID 134357306
N-[2-chloro-4-(trifluoromethoxy)phenyl]-3-(methylaminomethyl)-1H-indol-6-amine (PubChem CID 134357306) has the molecular formula C17H15ClF3N3O and a molecular weight of 369.77 g/mol. Its IUPAC name is N-[2-chloro-4-(trifluoromethoxy)phenyl]-3-(methylaminomethyl)-1H-indol-6-amine.
| Compound Name | N-[2-chloro-4-(trifluoromethoxy)phenyl]-3-(methylaminomethyl)-1H-indol-6-amine |
|---|---|
| PubChem CID | 134357306 |
| Molecular Formula | C17H15ClF3N3O |
| Molecular Weight | 369.77 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | N-[2-chloro-4-(trifluoromethoxy)phenyl]-3-(methylaminomethyl)-1H-indol-6-amine |
| SMILES | CNCc1c[nH]c2cc(Nc3ccc(OC(F)(F)F)cc3Cl)ccc12 |
| InChI | InChI=1S/C17H15ClF3N3O/c1-22-8-10-9-23-16-6-11(2-4-13(10)16)24-15-5-3-12(7-14(15)18)25-17(19,20)21/h2-7,9,22-24H,8H2,1H3 |
| InChIKey | KCYMVFKXQJJGQR-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 49.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.77 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |