C16H14F3N3 — CID 134357602
3-(methylaminomethyl)-N-(2,4,6-trifluorophenyl)-1H-indol-6-amine (PubChem CID 134357602) has the molecular formula C16H14F3N3 and a molecular weight of 305.30 g/mol. Its IUPAC name is 3-(methylaminomethyl)-N-(2,4,6-trifluorophenyl)-1H-indol-6-amine.
| Compound Name | 3-(methylaminomethyl)-N-(2,4,6-trifluorophenyl)-1H-indol-6-amine |
|---|---|
| PubChem CID | 134357602 |
| Molecular Formula | C16H14F3N3 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 3-(methylaminomethyl)-N-(2,4,6-trifluorophenyl)-1H-indol-6-amine |
| SMILES | CNCc1c[nH]c2cc(Nc3c(F)cc(F)cc3F)ccc12 |
| InChI | InChI=1S/C16H14F3N3/c1-20-7-9-8-21-15-6-11(2-3-12(9)15)22-16-13(18)4-10(17)5-14(16)19/h2-6,8,20-22H,7H2,1H3 |
| InChIKey | HGFNAWUVKSJWOV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |