C22H25N5OS — CID 144821388
N-(6-methoxy-2-methyl-3-pyridinyl)-3-(methylaminomethyl)-1H-indol-6-amine;pyridine-3-thiol (PubChem CID 144821388) has the molecular formula C22H25N5OS and a molecular weight of 407.54 g/mol. Its IUPAC name is N-(6-methoxy-2-methyl-3-pyridinyl)-3-(methylaminomethyl)-1H-indol-6-amine;pyridine-3-thiol.
| Compound Name | N-(6-methoxy-2-methyl-3-pyridinyl)-3-(methylaminomethyl)-1H-indol-6-amine;pyridine-3-thiol |
|---|---|
| PubChem CID | 144821388 |
| Molecular Formula | C22H25N5OS |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | N-(6-methoxy-2-methyl-3-pyridinyl)-3-(methylaminomethyl)-1H-indol-6-amine;pyridine-3-thiol |
| SMILES | CNCc1c[nH]c2cc(Nc3ccc(OC)nc3C)ccc12.Sc1cccnc1 |
| InChI | InChI=1S/C17H20N4O.C5H5NS/c1-11-15(6-7-17(20-11)22-3)21-13-4-5-14-12(9-18-2)10-19-16(14)8-13;7-5-2-1-3-6-4-5/h4-8,10,18-19,21H,9H2,1-3H3;1-4,7H |
| InChIKey | NAAWRISDNJUHKD-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 74.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|