C23H21ClF3N3S — CID 144821384
1-[6-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]-1H-indol-3-yl]-N-methylmethanamine;pyridine-3-thiol (PubChem CID 144821384) has the molecular formula C23H21ClF3N3S and a molecular weight of 463.96 g/mol. Its IUPAC name is 1-[6-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]-1H-indol-3-yl]-N-methylmethanamine;pyridine-3-thiol.
| Compound Name | 1-[6-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]-1H-indol-3-yl]-N-methylmethanamine;pyridine-3-thiol |
|---|---|
| PubChem CID | 144821384 |
| Molecular Formula | C23H21ClF3N3S |
| Molecular Weight | 463.96 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | 1-[6-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]-1H-indol-3-yl]-N-methylmethanamine;pyridine-3-thiol |
| SMILES | CNCc1c[nH]c2cc(Cc3ccc(Cl)cc3C(F)(F)F)ccc12.Sc1cccnc1 |
| InChI | InChI=1S/C18H16ClF3N2.C5H5NS/c1-23-9-13-10-24-17-7-11(2-5-15(13)17)6-12-3-4-14(19)8-16(12)18(20,21)22;7-5-2-1-3-6-4-5/h2-5,7-8,10,23-24H,6,9H2,1H3;1-4,7H |
| InChIKey | WBXCSSUQAKFKAA-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.96 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|