C22H22F3N5S — CID 144821362
3-(methylaminomethyl)-N-[2-methyl-6-(trifluoromethyl)-3-pyridinyl]-1H-indol-6-amine;pyridine-3-thiol (PubChem CID 144821362) has the molecular formula C22H22F3N5S and a molecular weight of 445.51 g/mol. Its IUPAC name is 3-(methylaminomethyl)-N-[2-methyl-6-(trifluoromethyl)-3-pyridinyl]-1H-indol-6-amine;pyridine-3-thiol.
| Compound Name | 3-(methylaminomethyl)-N-[2-methyl-6-(trifluoromethyl)-3-pyridinyl]-1H-indol-6-amine;pyridine-3-thiol |
|---|---|
| PubChem CID | 144821362 |
| Molecular Formula | C22H22F3N5S |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 3-(methylaminomethyl)-N-[2-methyl-6-(trifluoromethyl)-3-pyridinyl]-1H-indol-6-amine;pyridine-3-thiol |
| SMILES | CNCc1c[nH]c2cc(Nc3ccc(C(F)(F)F)nc3C)ccc12.Sc1cccnc1 |
| InChI | InChI=1S/C17H17F3N4.C5H5NS/c1-10-14(5-6-16(23-10)17(18,19)20)24-12-3-4-13-11(8-21-2)9-22-15(13)7-12;7-5-2-1-3-6-4-5/h3-7,9,21-22,24H,8H2,1-2H3;1-4,7H |
| InChIKey | NLEMCKKDPQVMIF-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|