C15H11ClF2N2 — CID 83081633
2-chloro-4,6-difluoro-N-(1H-indol-3-ylmethyl)aniline (PubChem CID 83081633) has the molecular formula C15H11ClF2N2 and a molecular weight of 292.72 g/mol. Its IUPAC name is 2-chloro-4,6-difluoro-N-(1H-indol-3-ylmethyl)aniline.
| Compound Name | 2-chloro-4,6-difluoro-N-(1H-indol-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 83081633 |
| Molecular Formula | C15H11ClF2N2 |
| Molecular Weight | 292.72 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 2-chloro-4,6-difluoro-N-(1H-indol-3-ylmethyl)aniline |
| SMILES | Fc1cc(F)c(NCc2c[nH]c3ccccc23)c(Cl)c1 |
| InChI | InChI=1S/C15H11ClF2N2/c16-12-5-10(17)6-13(18)15(12)20-8-9-7-19-14-4-2-1-3-11(9)14/h1-7,19-20H,8H2 |
| InChIKey | UTPHQLQWYKAZDW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.72 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |