C15H14FN3 — CID 115124152
4-fluoro-2-N-(1H-indol-3-ylmethyl)benzene-1,2-diamine (PubChem CID 115124152) has the molecular formula C15H14FN3 and a molecular weight of 255.30 g/mol. Its IUPAC name is 4-fluoro-2-N-(1H-indol-3-ylmethyl)benzene-1,2-diamine.
| Compound Name | 4-fluoro-2-N-(1H-indol-3-ylmethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 115124152 |
| Molecular Formula | C15H14FN3 |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 4-fluoro-2-N-(1H-indol-3-ylmethyl)benzene-1,2-diamine |
| SMILES | Nc1ccc(F)cc1NCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C15H14FN3/c16-11-5-6-13(17)15(7-11)19-9-10-8-18-14-4-2-1-3-12(10)14/h1-8,18-19H,9,17H2 |
| InChIKey | LKKGTNFEOHHHHJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|