C15H16N4 — CID 115147676
2-N-(1H-indol-3-ylmethyl)-6-methylpyridine-2,5-diamine (PubChem CID 115147676) has the molecular formula C15H16N4 and a molecular weight of 252.32 g/mol. Its IUPAC name is 2-N-(1H-indol-3-ylmethyl)-6-methylpyridine-2,5-diamine.
| Compound Name | 2-N-(1H-indol-3-ylmethyl)-6-methylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 115147676 |
| Molecular Formula | C15H16N4 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-N-(1H-indol-3-ylmethyl)-6-methylpyridine-2,5-diamine |
| SMILES | Cc1nc(NCc2c[nH]c3ccccc23)ccc1N |
| InChI | InChI=1S/C15H16N4/c1-10-13(16)6-7-15(19-10)18-9-11-8-17-14-5-3-2-4-12(11)14/h2-8,17H,9,16H2,1H3,(H,18,19) |
| InChIKey | ZNFSCFSTLWASQP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |