C22H21F3O5 — CID 11618671
2-methyl-2-[2-methyl-4-[4-[4-(trifluoromethoxy)phenyl]but-3-ynoxy]phenoxy]propanoic acid (PubChem CID 11618671) has the molecular formula C22H21F3O5 and a molecular weight of 422.40 g/mol. Its IUPAC name is 2-methyl-2-[2-methyl-4-[4-[4-(trifluoromethoxy)phenyl]but-3-ynoxy]phenoxy]propanoic acid.
| Compound Name | 2-methyl-2-[2-methyl-4-[4-[4-(trifluoromethoxy)phenyl]but-3-ynoxy]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 11618671 |
| Molecular Formula | C22H21F3O5 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 2-methyl-2-[2-methyl-4-[4-[4-(trifluoromethoxy)phenyl]but-3-ynoxy]phenoxy]propanoic acid |
| SMILES | Cc1cc(OCCC#Cc2ccc(OC(F)(F)F)cc2)ccc1OC(C)(C)C(=O)O |
| InChI | InChI=1S/C22H21F3O5/c1-15-14-18(11-12-19(15)30-21(2,3)20(26)27)28-13-5-4-6-16-7-9-17(10-8-16)29-22(23,24)25/h7-12,14H,5,13H2,1-3H3,(H,26,27) |
| InChIKey | SVTXQAUDUBQQOM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|