C29H34O5S — CID 58753769
2-[4-[3-(4-ethyl-2-phenylsulfanylphenoxy)butoxy]-2-methylphenoxy]-2-methylpropanoic acid (PubChem CID 58753769) has the molecular formula C29H34O5S and a molecular weight of 494.65 g/mol. Its IUPAC name is 2-[4-[3-(4-ethyl-2-phenylsulfanylphenoxy)butoxy]-2-methylphenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[3-(4-ethyl-2-phenylsulfanylphenoxy)butoxy]-2-methylphenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 58753769 |
| Molecular Formula | C29H34O5S |
| Molecular Weight | 494.65 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | 2-[4-[3-(4-ethyl-2-phenylsulfanylphenoxy)butoxy]-2-methylphenoxy]-2-methylpropanoic acid |
| SMILES | CCc1ccc(OC(C)CCOc2ccc(OC(C)(C)C(=O)O)c(C)c2)c(Sc2ccccc2)c1 |
| InChI | InChI=1S/C29H34O5S/c1-6-22-12-14-26(27(19-22)35-24-10-8-7-9-11-24)33-21(3)16-17-32-23-13-15-25(20(2)18-23)34-29(4,5)28(30)31/h7-15,18-19,21H,6,16-17H2,1-5H3,(H,30,31) |
| InChIKey | KJVDJPHKBADZQK-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.65 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |