C28H32O5 — CID 58753729
3-[4-[(2R)-4-(4-ethyl-2-phenoxyphenoxy)butan-2-yl]oxy-2-methylphenyl]propanoic acid (PubChem CID 58753729) has the molecular formula C28H32O5 and a molecular weight of 448.56 g/mol. Its IUPAC name is 3-[4-[(2R)-4-(4-ethyl-2-phenoxyphenoxy)butan-2-yl]oxy-2-methylphenyl]propanoic acid.
| Compound Name | 3-[4-[(2R)-4-(4-ethyl-2-phenoxyphenoxy)butan-2-yl]oxy-2-methylphenyl]propanoic acid |
|---|---|
| PubChem CID | 58753729 |
| Molecular Formula | C28H32O5 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 3-[4-[(2R)-4-(4-ethyl-2-phenoxyphenoxy)butan-2-yl]oxy-2-methylphenyl]propanoic acid |
| SMILES | CCc1ccc(OCC[C@@H](C)Oc2ccc(CCC(=O)O)c(C)c2)c(Oc2ccccc2)c1 |
| InChI | InChI=1S/C28H32O5/c1-4-22-10-14-26(27(19-22)33-24-8-6-5-7-9-24)31-17-16-21(3)32-25-13-11-23(20(2)18-25)12-15-28(29)30/h5-11,13-14,18-19,21H,4,12,15-17H2,1-3H3,(H,29,30)/t21-/m1/s1 |
| InChIKey | HSWWPPNZVFQQPP-OAQYLSRUSA-N |
| XLogP | 6.60 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |