C29H34O5 — CID 11784494
3-[2-methyl-4-[(3R)-3-(2-phenoxy-4-propan-2-ylphenoxy)butoxy]phenyl]propanoic acid (PubChem CID 11784494) has the molecular formula C29H34O5 and a molecular weight of 462.59 g/mol. Its IUPAC name is 3-[2-methyl-4-[(3R)-3-(2-phenoxy-4-propan-2-ylphenoxy)butoxy]phenyl]propanoic acid.
| Compound Name | 3-[2-methyl-4-[(3R)-3-(2-phenoxy-4-propan-2-ylphenoxy)butoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 11784494 |
| Molecular Formula | C29H34O5 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | 3-[2-methyl-4-[(3R)-3-(2-phenoxy-4-propan-2-ylphenoxy)butoxy]phenyl]propanoic acid |
| SMILES | Cc1cc(OCC[C@@H](C)Oc2ccc(C(C)C)cc2Oc2ccccc2)ccc1CCC(=O)O |
| InChI | InChI=1S/C29H34O5/c1-20(2)24-11-14-27(28(19-24)34-25-8-6-5-7-9-25)33-22(4)16-17-32-26-13-10-23(21(3)18-26)12-15-29(30)31/h5-11,13-14,18-20,22H,12,15-17H2,1-4H3,(H,30,31)/t22-/m1/s1 |
| InChIKey | XIMDCNRUDTUQFJ-JOCHJYFZSA-N |
| XLogP | 7.16 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |