C30H35NO5 — CID 87922701
3-[4-[(3R)-3-[4-ethyl-2-(N-methoxy-C-phenylcarbonimidoyl)phenoxy]butoxy]-2-methylphenyl]propanoic acid (PubChem CID 87922701) has the molecular formula C30H35NO5 and a molecular weight of 489.61 g/mol. Its IUPAC name is 3-[4-[(3R)-3-[4-ethyl-2-(N-methoxy-C-phenylcarbonimidoyl)phenoxy]butoxy]-2-methylphenyl]propanoic acid.
| Compound Name | 3-[4-[(3R)-3-[4-ethyl-2-(N-methoxy-C-phenylcarbonimidoyl)phenoxy]butoxy]-2-methylphenyl]propanoic acid |
|---|---|
| PubChem CID | 87922701 |
| Molecular Formula | C30H35NO5 |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | 3-[4-[(3R)-3-[4-ethyl-2-(N-methoxy-C-phenylcarbonimidoyl)phenoxy]butoxy]-2-methylphenyl]propanoic acid |
| SMILES | CCc1ccc(O[C@H](C)CCOc2ccc(CCC(=O)O)c(C)c2)c(C(=NOC)c2ccccc2)c1 |
| InChI | InChI=1S/C30H35NO5/c1-5-23-11-15-28(27(20-23)30(31-34-4)25-9-7-6-8-10-25)36-22(3)17-18-35-26-14-12-24(21(2)19-26)13-16-29(32)33/h6-12,14-15,19-20,22H,5,13,16-18H2,1-4H3,(H,32,33)/t22-/m1/s1 |
| InChIKey | FOHOYQFJHBMCTN-JOCHJYFZSA-N |
| XLogP | 6.21 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|