C23H30O4 — CID 143007390
methyl 3-[4-[4-(4-ethylphenoxy)butan-2-yloxy]-2-methylphenyl]propanoate (PubChem CID 143007390) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is methyl 3-[4-[4-(4-ethylphenoxy)butan-2-yloxy]-2-methylphenyl]propanoate.
| Compound Name | methyl 3-[4-[4-(4-ethylphenoxy)butan-2-yloxy]-2-methylphenyl]propanoate |
|---|---|
| PubChem CID | 143007390 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | methyl 3-[4-[4-(4-ethylphenoxy)butan-2-yloxy]-2-methylphenyl]propanoate |
| SMILES | CCc1ccc(OCCC(C)Oc2ccc(CCC(=O)OC)c(C)c2)cc1 |
| InChI | InChI=1S/C23H30O4/c1-5-19-6-10-21(11-7-19)26-15-14-18(3)27-22-12-8-20(17(2)16-22)9-13-23(24)25-4/h6-8,10-12,16,18H,5,9,13-15H2,1-4H3 |
| InChIKey | GOIMRLWMHBOQAO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |