C30H38O5 — CID 143007296
[5-ethyl-2-[(2R)-4-(3-methyl-4-propylphenoxy)butan-2-yl]oxyphenyl]-phenylmethanol;formic acid (PubChem CID 143007296) has the molecular formula C30H38O5 and a molecular weight of 478.63 g/mol. Its IUPAC name is [5-ethyl-2-[(2R)-4-(3-methyl-4-propylphenoxy)butan-2-yl]oxyphenyl]-phenylmethanol;formic acid.
| Compound Name | [5-ethyl-2-[(2R)-4-(3-methyl-4-propylphenoxy)butan-2-yl]oxyphenyl]-phenylmethanol;formic acid |
|---|---|
| PubChem CID | 143007296 |
| Molecular Formula | C30H38O5 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | [5-ethyl-2-[(2R)-4-(3-methyl-4-propylphenoxy)butan-2-yl]oxyphenyl]-phenylmethanol;formic acid |
| SMILES | CCCc1ccc(OCC[C@@H](C)Oc2ccc(CC)cc2C(O)c2ccccc2)cc1C.O=CO |
| InChI | InChI=1S/C29H36O3.CH2O2/c1-5-10-24-14-15-26(19-21(24)3)31-18-17-22(4)32-28-16-13-23(6-2)20-27(28)29(30)25-11-8-7-9-12-25;2-1-3/h7-9,11-16,19-20,22,29-30H,5-6,10,17-18H2,1-4H3;1H,(H,2,3)/t22-,29?;/m1./s1 |
| InChIKey | SKTHQRPYNYATHU-SPOHAGFXSA-N |
| XLogP | 6.53 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|