C32H40O5 — CID 58753906
ethyl 3-[2-ethyl-4-[(3R)-3-[4-ethyl-2-(2-methylphenoxy)phenoxy]butoxy]phenyl]propanoate (PubChem CID 58753906) has the molecular formula C32H40O5 and a molecular weight of 504.67 g/mol. Its IUPAC name is ethyl 3-[2-ethyl-4-[(3R)-3-[4-ethyl-2-(2-methylphenoxy)phenoxy]butoxy]phenyl]propanoate.
| Compound Name | ethyl 3-[2-ethyl-4-[(3R)-3-[4-ethyl-2-(2-methylphenoxy)phenoxy]butoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 58753906 |
| Molecular Formula | C32H40O5 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | ethyl 3-[2-ethyl-4-[(3R)-3-[4-ethyl-2-(2-methylphenoxy)phenoxy]butoxy]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(OCC[C@@H](C)Oc2ccc(CC)cc2Oc2ccccc2C)cc1CC |
| InChI | InChI=1S/C32H40O5/c1-6-25-13-17-30(31(21-25)37-29-12-10-9-11-23(29)4)36-24(5)19-20-35-28-16-14-27(26(7-2)22-28)15-18-32(33)34-8-3/h9-14,16-17,21-22,24H,6-8,15,18-20H2,1-5H3/t24-/m1/s1 |
| InChIKey | JPWGMTZARVDODY-XMMPIXPASA-N |
| XLogP | 7.64 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |