C27H30ClNO5 — CID 58753823
ethyl 3-[5-[(3R)-3-(4-chloro-2-phenoxyphenoxy)butoxy]-3-methyl-2-pyridinyl]propanoate (PubChem CID 58753823) has the molecular formula C27H30ClNO5 and a molecular weight of 483.99 g/mol. Its IUPAC name is ethyl 3-[5-[(3R)-3-(4-chloro-2-phenoxyphenoxy)butoxy]-3-methyl-2-pyridinyl]propanoate.
| Compound Name | ethyl 3-[5-[(3R)-3-(4-chloro-2-phenoxyphenoxy)butoxy]-3-methyl-2-pyridinyl]propanoate |
|---|---|
| PubChem CID | 58753823 |
| Molecular Formula | C27H30ClNO5 |
| Molecular Weight | 483.99 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | ethyl 3-[5-[(3R)-3-(4-chloro-2-phenoxyphenoxy)butoxy]-3-methyl-2-pyridinyl]propanoate |
| SMILES | CCOC(=O)CCc1ncc(OCC[C@@H](C)Oc2ccc(Cl)cc2Oc2ccccc2)cc1C |
| InChI | InChI=1S/C27H30ClNO5/c1-4-31-27(30)13-11-24-19(2)16-23(18-29-24)32-15-14-20(3)33-25-12-10-21(28)17-26(25)34-22-8-6-5-7-9-22/h5-10,12,16-18,20H,4,11,13-15H2,1-3H3/t20-/m1/s1 |
| InChIKey | WFQNZGNWNPVPOK-HXUWFJFHSA-N |
| XLogP | 6.57 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.99 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |