C25H24ClFO5 — CID 69424382
3-[4-[3-(4-chloro-2-phenoxyphenoxy)butoxy]-2-fluorophenyl]propanoic acid (PubChem CID 69424382) has the molecular formula C25H24ClFO5 and a molecular weight of 458.91 g/mol. Its IUPAC name is 3-[4-[3-(4-chloro-2-phenoxyphenoxy)butoxy]-2-fluorophenyl]propanoic acid.
| Compound Name | 3-[4-[3-(4-chloro-2-phenoxyphenoxy)butoxy]-2-fluorophenyl]propanoic acid |
|---|---|
| PubChem CID | 69424382 |
| Molecular Formula | C25H24ClFO5 |
| Molecular Weight | 458.91 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 3-[4-[3-(4-chloro-2-phenoxyphenoxy)butoxy]-2-fluorophenyl]propanoic acid |
| SMILES | CC(CCOc1ccc(CCC(=O)O)c(F)c1)Oc1ccc(Cl)cc1Oc1ccccc1 |
| InChI | InChI=1S/C25H24ClFO5/c1-17(13-14-30-21-10-7-18(22(27)16-21)8-12-25(28)29)31-23-11-9-19(26)15-24(23)32-20-5-3-2-4-6-20/h2-7,9-11,15-17H,8,12-14H2,1H3,(H,28,29) |
| InChIKey | WXCQOBJBCVSXBR-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.91 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |