C20H23ClO4 — CID 20989531
3-[5-chloro-2-[2-(4-propan-2-ylphenoxy)ethoxy]phenyl]propanoic acid (PubChem CID 20989531) has the molecular formula C20H23ClO4 and a molecular weight of 362.85 g/mol. Its IUPAC name is 3-[5-chloro-2-[2-(4-propan-2-ylphenoxy)ethoxy]phenyl]propanoic acid.
| Compound Name | 3-[5-chloro-2-[2-(4-propan-2-ylphenoxy)ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 20989531 |
| Molecular Formula | C20H23ClO4 |
| Molecular Weight | 362.85 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 3-[5-chloro-2-[2-(4-propan-2-ylphenoxy)ethoxy]phenyl]propanoic acid |
| SMILES | CC(C)c1ccc(OCCOc2ccc(Cl)cc2CCC(=O)O)cc1 |
| InChI | InChI=1S/C20H23ClO4/c1-14(2)15-3-7-18(8-4-15)24-11-12-25-19-9-6-17(21)13-16(19)5-10-20(22)23/h3-4,6-9,13-14H,5,10-12H2,1-2H3,(H,22,23) |
| InChIKey | PCZQBKCBOXRXFB-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.85 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|