C18H19BrO4 — CID 20992818
3-[5-bromo-2-[2-(4-methylphenoxy)ethoxy]phenyl]propanoic acid (PubChem CID 20992818) has the molecular formula C18H19BrO4 and a molecular weight of 379.25 g/mol. Its IUPAC name is 3-[5-bromo-2-[2-(4-methylphenoxy)ethoxy]phenyl]propanoic acid.
| Compound Name | 3-[5-bromo-2-[2-(4-methylphenoxy)ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 20992818 |
| Molecular Formula | C18H19BrO4 |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 3-[5-bromo-2-[2-(4-methylphenoxy)ethoxy]phenyl]propanoic acid |
| SMILES | Cc1ccc(OCCOc2ccc(Br)cc2CCC(=O)O)cc1 |
| InChI | InChI=1S/C18H19BrO4/c1-13-2-6-16(7-3-13)22-10-11-23-17-8-5-15(19)12-14(17)4-9-18(20)21/h2-3,5-8,12H,4,9-11H2,1H3,(H,20,21) |
| InChIKey | REBBPRRDORAXLH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|