3-(5-bromo-2-sulfanylphenyl)propanoic acid

C9H9BrO2S — CID 130792995

IUPAC3-(5-bromo-2-sulfanylphenyl)propanoic acid
SMILESO=C(O)CCc1cc(Br)ccc1S
InChIInChI=1S/C9H9BrO2S/c10-7-2-3-8(13)6(5-7)1-4-9(11)12/h2-3,5,13H,1,4H2,(H,11,12)
InChIKeyDSQYLTSMCCKUIR-UHFFFAOYSA-N
MW261.14 g/mol
LogP2.76
Rot. Bonds3

About 3-(5-bromo-2-sulfanylphenyl)propanoic acid

3-(5-bromo-2-sulfanylphenyl)propanoic acid (PubChem CID 130792995) has the molecular formula C9H9BrO2S and a molecular weight of 261.14 g/mol. Its IUPAC name is 3-(5-bromo-2-sulfanylphenyl)propanoic acid.

Molecular Properties

Compound Name3-(5-bromo-2-sulfanylphenyl)propanoic acid
PubChem CID130792995
Molecular FormulaC9H9BrO2S
Molecular Weight261.14 g/mol
Exact Mass259.95
IUPAC Name3-(5-bromo-2-sulfanylphenyl)propanoic acid
SMILESO=C(O)CCc1cc(Br)ccc1S
InChIInChI=1S/C9H9BrO2S/c10-7-2-3-8(13)6(5-7)1-4-9(11)12/h2-3,5,13H,1,4H2,(H,11,12)
InChIKeyDSQYLTSMCCKUIR-UHFFFAOYSA-N
XLogP2.76
TPSA37.30 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.14
LogP ≤ 52.76
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze 3-(5-bromo-2-sulfanylphenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-[5-bromo-2-(fluoromethyl)phenyl]propanoic acid
CID 134622221
3-(4-bromo-2-methylphenyl)propanoic acid
CID 69202839
4-bromo-2-(3-bromopropyl)benzenethiol
CID 131117430
3-(6-bromo-1-benzothiophen-3-yl)propanoic acid
CID 117121877
2-[5-bromo-2-(sulfanylmethyl)phenyl]acetic acid
CID 91874414
3-(5-bromo-3-chloro-2-methylphenyl)propanoic acid
CID 84714681
3-(5-bromo-3-chloro-2-hydroxyphenyl)propanoic acid
CID 142920745
3-[5-bromo-2-[2-(4-methylphenoxy)ethoxy]phenyl]propanoic acid
CID 20992818
3-(6-bromo-1-ethylindol-3-yl)propanoic acid
CID 117122264
3-[5-bromo-2-[2-(2,5-dimethylphenoxy)ethoxy]phenyl]propanoic acid
CID 20989144
3-(2-bromo-5-cyanophenyl)propanoic acid
CID 130822902
3-[2-(5-bromo-2-fluorophenyl)ethyl-methylamino]propanoic acid
CID 115005644

Frequently Asked Questions

What is the IUPAC name of 3-(5-bromo-2-sulfanylphenyl)propanoic acid?
The IUPAC name of 3-(5-bromo-2-sulfanylphenyl)propanoic acid (CID 130792995) is 3-(5-bromo-2-sulfanylphenyl)propanoic acid.
What is the SMILES notation for 3-(5-bromo-2-sulfanylphenyl)propanoic acid?
The canonical SMILES for 3-(5-bromo-2-sulfanylphenyl)propanoic acid is O=C(O)CCc1cc(Br)ccc1S.
What is the InChIKey of 3-(5-bromo-2-sulfanylphenyl)propanoic acid?
The InChIKey is DSQYLTSMCCKUIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrO2S/c10-7-2-3-8(13)6(5-7)1-4-9(11)12/h2-3,5,13H,1,4H2,(H,11,12).
What are the key properties of 3-(5-bromo-2-sulfanylphenyl)propanoic acid?
3-(5-bromo-2-sulfanylphenyl)propanoic acid has a molecular weight of 261.14 g/mol, XLogP of 2.76, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-bromo-2-sulfanylphenyl)propanoic acid is sourced from PubChem (CID 130792995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).