C12H15BrFNO2 — CID 115005644
3-[2-(5-bromo-2-fluorophenyl)ethyl-methylamino]propanoic acid (PubChem CID 115005644) has the molecular formula C12H15BrFNO2 and a molecular weight of 304.16 g/mol. Its IUPAC name is 3-[2-(5-bromo-2-fluorophenyl)ethyl-methylamino]propanoic acid.
| Compound Name | 3-[2-(5-bromo-2-fluorophenyl)ethyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 115005644 |
| Molecular Formula | C12H15BrFNO2 |
| Molecular Weight | 304.16 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 3-[2-(5-bromo-2-fluorophenyl)ethyl-methylamino]propanoic acid |
| SMILES | CN(CCC(=O)O)CCc1cc(Br)ccc1F |
| InChI | InChI=1S/C12H15BrFNO2/c1-15(7-5-12(16)17)6-4-9-8-10(13)2-3-11(9)14/h2-3,8H,4-7H2,1H3,(H,16,17) |
| InChIKey | VSBNYHNCMKHBRP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.16 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |