C11H15BrFN — CID 115259643
2-(5-bromo-2-fluorophenyl)-N-ethyl-N-methylethanamine (PubChem CID 115259643) has the molecular formula C11H15BrFN and a molecular weight of 260.15 g/mol. Its IUPAC name is 2-(5-bromo-2-fluorophenyl)-N-ethyl-N-methylethanamine.
| Compound Name | 2-(5-bromo-2-fluorophenyl)-N-ethyl-N-methylethanamine |
|---|---|
| PubChem CID | 115259643 |
| Molecular Formula | C11H15BrFN |
| Molecular Weight | 260.15 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 2-(5-bromo-2-fluorophenyl)-N-ethyl-N-methylethanamine |
| SMILES | CCN(C)CCc1cc(Br)ccc1F |
| InChI | InChI=1S/C11H15BrFN/c1-3-14(2)7-6-9-8-10(12)4-5-11(9)13/h4-5,8H,3,6-7H2,1-2H3 |
| InChIKey | AEHKSXCLURMJAJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.15 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |