C30H33F3O4 — CID 58753848
ethyl 3-[2-ethyl-4-[(3R)-3-[2-phenyl-4-(trifluoromethyl)phenoxy]butoxy]phenyl]propanoate (PubChem CID 58753848) has the molecular formula C30H33F3O4 and a molecular weight of 514.58 g/mol. Its IUPAC name is ethyl 3-[2-ethyl-4-[(3R)-3-[2-phenyl-4-(trifluoromethyl)phenoxy]butoxy]phenyl]propanoate.
| Compound Name | ethyl 3-[2-ethyl-4-[(3R)-3-[2-phenyl-4-(trifluoromethyl)phenoxy]butoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 58753848 |
| Molecular Formula | C30H33F3O4 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | ethyl 3-[2-ethyl-4-[(3R)-3-[2-phenyl-4-(trifluoromethyl)phenoxy]butoxy]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(OCC[C@@H](C)Oc2ccc(C(F)(F)F)cc2-c2ccccc2)cc1CC |
| InChI | InChI=1S/C30H33F3O4/c1-4-22-19-26(14-11-23(22)12-16-29(34)35-5-2)36-18-17-21(3)37-28-15-13-25(30(31,32)33)20-27(28)24-9-7-6-8-10-24/h6-11,13-15,19-21H,4-5,12,16-18H2,1-3H3/t21-/m1/s1 |
| InChIKey | WFMJVQDRUCUFIN-OAQYLSRUSA-N |
| XLogP | 7.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |