C13H13F5O4 — CID 134632352
ethyl 3-[2-(difluoromethoxy)-5-(trifluoromethoxy)phenyl]propanoate (PubChem CID 134632352) has the molecular formula C13H13F5O4 and a molecular weight of 328.23 g/mol. Its IUPAC name is ethyl 3-[2-(difluoromethoxy)-5-(trifluoromethoxy)phenyl]propanoate.
| Compound Name | ethyl 3-[2-(difluoromethoxy)-5-(trifluoromethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 134632352 |
| Molecular Formula | C13H13F5O4 |
| Molecular Weight | 328.23 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | ethyl 3-[2-(difluoromethoxy)-5-(trifluoromethoxy)phenyl]propanoate |
| SMILES | CCOC(=O)CCc1cc(OC(F)(F)F)ccc1OC(F)F |
| InChI | InChI=1S/C13H13F5O4/c1-2-20-11(19)6-3-8-7-9(22-13(16,17)18)4-5-10(8)21-12(14)15/h4-5,7,12H,2-3,6H2,1H3 |
| InChIKey | GSCWROUTJBABTE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.23 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |