C12H11F5O4 — CID 170997918
ethyl 2-[5-(difluoromethoxy)-2-(trifluoromethoxy)phenyl]acetate (PubChem CID 170997918) has the molecular formula C12H11F5O4 and a molecular weight of 314.21 g/mol. Its IUPAC name is ethyl 2-[5-(difluoromethoxy)-2-(trifluoromethoxy)phenyl]acetate.
| Compound Name | ethyl 2-[5-(difluoromethoxy)-2-(trifluoromethoxy)phenyl]acetate |
|---|---|
| PubChem CID | 170997918 |
| Molecular Formula | C12H11F5O4 |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | ethyl 2-[5-(difluoromethoxy)-2-(trifluoromethoxy)phenyl]acetate |
| SMILES | CCOC(=O)Cc1cc(OC(F)F)ccc1OC(F)(F)F |
| InChI | InChI=1S/C12H11F5O4/c1-2-19-10(18)6-7-5-8(20-11(13)14)3-4-9(7)21-12(15,16)17/h3-5,11H,2,6H2,1H3 |
| InChIKey | STEPXMIBIOBJOU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |