C12H14F2O4 — CID 134632626
ethyl 3-[4-(difluoromethoxy)-3-hydroxyphenyl]propanoate (PubChem CID 134632626) has the molecular formula C12H14F2O4 and a molecular weight of 260.24 g/mol. Its IUPAC name is ethyl 3-[4-(difluoromethoxy)-3-hydroxyphenyl]propanoate.
| Compound Name | ethyl 3-[4-(difluoromethoxy)-3-hydroxyphenyl]propanoate |
|---|---|
| PubChem CID | 134632626 |
| Molecular Formula | C12H14F2O4 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | ethyl 3-[4-(difluoromethoxy)-3-hydroxyphenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(OC(F)F)c(O)c1 |
| InChI | InChI=1S/C12H14F2O4/c1-2-17-11(16)6-4-8-3-5-10(9(15)7-8)18-12(13)14/h3,5,7,12,15H,2,4,6H2,1H3 |
| InChIKey | NDTSISNTPRXKRT-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |