C16H24O4 — CID 58753810
methyl 3-[4-(3-hydroxypentoxy)-2-methylphenyl]propanoate (PubChem CID 58753810) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is methyl 3-[4-(3-hydroxypentoxy)-2-methylphenyl]propanoate.
| Compound Name | methyl 3-[4-(3-hydroxypentoxy)-2-methylphenyl]propanoate |
|---|---|
| PubChem CID | 58753810 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | methyl 3-[4-(3-hydroxypentoxy)-2-methylphenyl]propanoate |
| SMILES | CCC(O)CCOc1ccc(CCC(=O)OC)c(C)c1 |
| InChI | InChI=1S/C16H24O4/c1-4-14(17)9-10-20-15-7-5-13(12(2)11-15)6-8-16(18)19-3/h5,7,11,14,17H,4,6,8-10H2,1-3H3 |
| InChIKey | WYSGIUQTIJVCHX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |