C30H38O4S — CID 143007387
ethane;3-[2-methyl-4-[3-(2-phenoxy-4-propan-2-ylphenoxy)propylsulfanyl]phenyl]propanoic acid (PubChem CID 143007387) has the molecular formula C30H38O4S and a molecular weight of 494.70 g/mol. Its IUPAC name is ethane;3-[2-methyl-4-[3-(2-phenoxy-4-propan-2-ylphenoxy)propylsulfanyl]phenyl]propanoic acid.
| Compound Name | ethane;3-[2-methyl-4-[3-(2-phenoxy-4-propan-2-ylphenoxy)propylsulfanyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 143007387 |
| Molecular Formula | C30H38O4S |
| Molecular Weight | 494.70 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | ethane;3-[2-methyl-4-[3-(2-phenoxy-4-propan-2-ylphenoxy)propylsulfanyl]phenyl]propanoic acid |
| SMILES | CC.Cc1cc(SCCCOc2ccc(C(C)C)cc2Oc2ccccc2)ccc1CCC(=O)O |
| InChI | InChI=1S/C28H32O4S.C2H6/c1-20(2)23-11-14-26(27(19-23)32-24-8-5-4-6-9-24)31-16-7-17-33-25-13-10-22(21(3)18-25)12-15-28(29)30;1-2/h4-6,8-11,13-14,18-20H,7,12,15-17H2,1-3H3,(H,29,30);1-2H3 |
| InChIKey | UZQSSOFUURDSLW-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.70 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|