C24H22F3NO4 — CID 68826126
ethyl 2-[6-[5-[4-(trifluoromethoxy)phenyl]pent-4-ynoxy]indol-1-yl]acetate (PubChem CID 68826126) has the molecular formula C24H22F3NO4 and a molecular weight of 445.44 g/mol. Its IUPAC name is ethyl 2-[6-[5-[4-(trifluoromethoxy)phenyl]pent-4-ynoxy]indol-1-yl]acetate.
| Compound Name | ethyl 2-[6-[5-[4-(trifluoromethoxy)phenyl]pent-4-ynoxy]indol-1-yl]acetate |
|---|---|
| PubChem CID | 68826126 |
| Molecular Formula | C24H22F3NO4 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | ethyl 2-[6-[5-[4-(trifluoromethoxy)phenyl]pent-4-ynoxy]indol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1ccc2ccc(OCCCC#Cc3ccc(OC(F)(F)F)cc3)cc21 |
| InChI | InChI=1S/C24H22F3NO4/c1-2-30-23(29)17-28-14-13-19-9-12-21(16-22(19)28)31-15-5-3-4-6-18-7-10-20(11-8-18)32-24(25,26)27/h7-14,16H,2-3,5,15,17H2,1H3 |
| InChIKey | ODDKQLWTKLNVBM-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|