C15H16F3N3O4 — CID 159826725
ethyl 2-(6-carbamimidoylindol-1-yl)acetate;2,2,2-trifluoroacetic acid (PubChem CID 159826725) has the molecular formula C15H16F3N3O4 and a molecular weight of 359.30 g/mol. Its IUPAC name is ethyl 2-(6-carbamimidoylindol-1-yl)acetate;2,2,2-trifluoroacetic acid.
| Compound Name | ethyl 2-(6-carbamimidoylindol-1-yl)acetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 159826725 |
| Molecular Formula | C15H16F3N3O4 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | ethyl 2-(6-carbamimidoylindol-1-yl)acetate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc2ccn(CC(=O)OCC)c2c1 |
| InChI | InChI=1S/C13H15N3O2.C2HF3O2/c1-2-18-12(17)8-16-6-5-9-3-4-10(13(14)15)7-11(9)16;3-2(4,5)1(6)7/h3-7H,2,8H2,1H3,(H3,14,15);(H,6,7) |
| InChIKey | NMXWHJJFIOWXGA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 118.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|