C9H12N4O4 — CID 118972563
ethyl 2-(5-carbamimidoyl-2,4-dioxopyrimidin-1-yl)acetate (PubChem CID 118972563) has the molecular formula C9H12N4O4 and a molecular weight of 240.22 g/mol. Its IUPAC name is ethyl 2-(5-carbamimidoyl-2,4-dioxopyrimidin-1-yl)acetate.
| Compound Name | ethyl 2-(5-carbamimidoyl-2,4-dioxopyrimidin-1-yl)acetate |
|---|---|
| PubChem CID | 118972563 |
| Molecular Formula | C9H12N4O4 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | ethyl 2-(5-carbamimidoyl-2,4-dioxopyrimidin-1-yl)acetate |
| SMILES | [H]/N=C(\N)c1cn(CC(=O)OCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H12N4O4/c1-2-17-6(14)4-13-3-5(7(10)11)8(15)12-9(13)16/h3H,2,4H2,1H3,(H3,10,11)(H,12,15,16) |
| InChIKey | NYPHRXZMUHPCDK-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|