About ethyl 2-(5-bromo-2-imino-1-pyridinyl)acetate;hydrobromide
ethyl 2-(5-bromo-2-imino-1-pyridinyl)acetate;hydrobromide (PubChem CID 86652071) has the molecular formula C9H12Br2N2O2
and a molecular weight of 340.02 g/mol. Its IUPAC name is ethyl 2-(5-bromo-2-imino-1-pyridinyl)acetate;hydrobromide.
Molecular Properties
| Compound Name | ethyl 2-(5-bromo-2-imino-1-pyridinyl)acetate;hydrobromide |
| PubChem CID | 86652071 |
| Molecular Formula | C9H12Br2N2O2 |
| Molecular Weight | 340.02 g/mol |
| Exact Mass | 337.93 |
| IUPAC Name | ethyl 2-(5-bromo-2-imino-1-pyridinyl)acetate;hydrobromide |
| SMILES | Br.[H]/N=c1\ccc(Br)cn1CC(=O)OCC |
| InChI | InChI=1S/C9H11BrN2O2.BrH/c1-2-14-9(13)6-12-5-7(10)3-4-8(12)11;/h3-5,11H,2,6H2,1H3;1H/b11-8+; |
| InChIKey | MKCIRAUGUFNZFY-YGCVIUNWSA-N |
| XLogP | 1.87 |
| TPSA | 55.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.02 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-(5-bromo-2-imino-1-pyridinyl)acetate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(5-bromo-2-imino-1-pyridinyl)acetate;hydrobromide?
The IUPAC name of ethyl 2-(5-bromo-2-imino-1-pyridinyl)acetate;hydrobromide (CID 86652071) is ethyl 2-(5-bromo-2-imino-1-pyridinyl)acetate;hydrobromide.
What is the SMILES notation for ethyl 2-(5-bromo-2-imino-1-pyridinyl)acetate;hydrobromide?
The canonical SMILES for ethyl 2-(5-bromo-2-imino-1-pyridinyl)acetate;hydrobromide is Br.[H]/N=c1\ccc(Br)cn1CC(=O)OCC.
What is the InChIKey of ethyl 2-(5-bromo-2-imino-1-pyridinyl)acetate;hydrobromide?
The InChIKey is MKCIRAUGUFNZFY-YGCVIUNWSA-N. The full InChI is InChI=1S/C9H11BrN2O2.BrH/c1-2-14-9(13)6-12-5-7(10)3-4-8(12)11;/h3-5,11H,2,6H2,1H3;1H/b11-8+;.
What are the key properties of ethyl 2-(5-bromo-2-imino-1-pyridinyl)acetate;hydrobromide?
ethyl 2-(5-bromo-2-imino-1-pyridinyl)acetate;hydrobromide has a molecular weight of 340.02 g/mol, XLogP of 1.87, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(5-bromo-2-imino-1-pyridinyl)acetate;hydrobromide is sourced from PubChem (CID 86652071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).