C11H10BrNO3S — CID 129219762
ethyl 2-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)acetate (PubChem CID 129219762) has the molecular formula C11H10BrNO3S and a molecular weight of 316.18 g/mol. Its IUPAC name is ethyl 2-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)acetate.
| Compound Name | ethyl 2-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)acetate |
|---|---|
| PubChem CID | 129219762 |
| Molecular Formula | C11H10BrNO3S |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 314.96 |
| IUPAC Name | ethyl 2-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)acetate |
| SMILES | CCOC(=O)Cn1ccc2scc(Br)c2c1=O |
| InChI | InChI=1S/C11H10BrNO3S/c1-2-16-9(14)5-13-4-3-8-10(11(13)15)7(12)6-17-8/h3-4,6H,2,5H2,1H3 |
| InChIKey | HJFMBFHSNNZPOO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |