C12H12BrNO3S — CID 129219761
ethyl 3-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)propanoate (PubChem CID 129219761) has the molecular formula C12H12BrNO3S and a molecular weight of 330.20 g/mol. Its IUPAC name is ethyl 3-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)propanoate.
| Compound Name | ethyl 3-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)propanoate |
|---|---|
| PubChem CID | 129219761 |
| Molecular Formula | C12H12BrNO3S |
| Molecular Weight | 330.20 g/mol |
| Exact Mass | 328.97 |
| IUPAC Name | ethyl 3-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)propanoate |
| SMILES | CCOC(=O)CCn1ccc2scc(Br)c2c1=O |
| InChI | InChI=1S/C12H12BrNO3S/c1-2-17-10(15)4-6-14-5-3-9-11(12(14)16)8(13)7-18-9/h3,5,7H,2,4,6H2,1H3 |
| InChIKey | QDVHLAITHPNHAG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.20 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |