C20H33N3O3 — CID 59626970
ethyl 2-[5-[bis(3-methylbutyl)carbamoyl]-2-imino-1-pyridinyl]acetate (PubChem CID 59626970) has the molecular formula C20H33N3O3 and a molecular weight of 363.50 g/mol. Its IUPAC name is ethyl 2-[5-[bis(3-methylbutyl)carbamoyl]-2-imino-1-pyridinyl]acetate.
| Compound Name | ethyl 2-[5-[bis(3-methylbutyl)carbamoyl]-2-imino-1-pyridinyl]acetate |
|---|---|
| PubChem CID | 59626970 |
| Molecular Formula | C20H33N3O3 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.25 |
| IUPAC Name | ethyl 2-[5-[bis(3-methylbutyl)carbamoyl]-2-imino-1-pyridinyl]acetate |
| SMILES | [H]/N=c1\ccc(C(=O)N(CCC(C)C)CCC(C)C)cn1CC(=O)OCC |
| InChI | InChI=1S/C20H33N3O3/c1-6-26-19(24)14-23-13-17(7-8-18(23)21)20(25)22(11-9-15(2)3)12-10-16(4)5/h7-8,13,15-16,21H,6,9-12,14H2,1-5H3/b21-18+ |
| InChIKey | PMYMUWGJUSKNOX-DYTRJAOYSA-N |
| XLogP | 3.07 |
| TPSA | 75.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |