C17H28N2O — CID 78848576
6-methyl-N,N-bis(3-methylbutyl)pyridine-2-carboxamide (PubChem CID 78848576) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is 6-methyl-N,N-bis(3-methylbutyl)pyridine-2-carboxamide.
| Compound Name | 6-methyl-N,N-bis(3-methylbutyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 78848576 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 6-methyl-N,N-bis(3-methylbutyl)pyridine-2-carboxamide |
| SMILES | Cc1cccc(C(=O)N(CCC(C)C)CCC(C)C)n1 |
| InChI | InChI=1S/C17H28N2O/c1-13(2)9-11-19(12-10-14(3)4)17(20)16-8-6-7-15(5)18-16/h6-8,13-14H,9-12H2,1-5H3 |
| InChIKey | VMNJPJVIZLJXEU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |