C11H11Br2NO4 — CID 113413565
ethyl 4-(3,5-dibromo-2-oxo-1-pyridinyl)-3-oxobutanoate (PubChem CID 113413565) has the molecular formula C11H11Br2NO4 and a molecular weight of 381.02 g/mol. Its IUPAC name is ethyl 4-(3,5-dibromo-2-oxo-1-pyridinyl)-3-oxobutanoate.
| Compound Name | ethyl 4-(3,5-dibromo-2-oxo-1-pyridinyl)-3-oxobutanoate |
|---|---|
| PubChem CID | 113413565 |
| Molecular Formula | C11H11Br2NO4 |
| Molecular Weight | 381.02 g/mol |
| Exact Mass | 378.91 |
| IUPAC Name | ethyl 4-(3,5-dibromo-2-oxo-1-pyridinyl)-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)Cn1cc(Br)cc(Br)c1=O |
| InChI | InChI=1S/C11H11Br2NO4/c1-2-18-10(16)4-8(15)6-14-5-7(12)3-9(13)11(14)17/h3,5H,2,4,6H2,1H3 |
| InChIKey | RXSSQWWHGPAJBU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.02 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|