C9H11NO4S — CID 63899098
ethyl 3-oxo-4-(2-oxo-1,3-thiazol-3-yl)butanoate (PubChem CID 63899098) has the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. Its IUPAC name is ethyl 3-oxo-4-(2-oxo-1,3-thiazol-3-yl)butanoate.
| Compound Name | ethyl 3-oxo-4-(2-oxo-1,3-thiazol-3-yl)butanoate |
|---|---|
| PubChem CID | 63899098 |
| Molecular Formula | C9H11NO4S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | ethyl 3-oxo-4-(2-oxo-1,3-thiazol-3-yl)butanoate |
| SMILES | CCOC(=O)CC(=O)Cn1ccsc1=O |
| InChI | InChI=1S/C9H11NO4S/c1-2-14-8(12)5-7(11)6-10-3-4-15-9(10)13/h3-4H,2,5-6H2,1H3 |
| InChIKey | GLNDNOXBXWSEKA-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|