C8H11NO2S — CID 63312936
3-(2-oxopentyl)-1,3-thiazol-2-one (PubChem CID 63312936) has the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. Its IUPAC name is 3-(2-oxopentyl)-1,3-thiazol-2-one.
| Compound Name | 3-(2-oxopentyl)-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 63312936 |
| Molecular Formula | C8H11NO2S |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | 3-(2-oxopentyl)-1,3-thiazol-2-one |
| SMILES | CCCC(=O)Cn1ccsc1=O |
| InChI | InChI=1S/C8H11NO2S/c1-2-3-7(10)6-9-4-5-12-8(9)11/h4-5H,2-3,6H2,1H3 |
| InChIKey | IJHHJNGNEFSCJL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |