C13H13NO3S — CID 63312406
3-[2-(4-ethoxyphenyl)-2-oxoethyl]-1,3-thiazol-2-one (PubChem CID 63312406) has the molecular formula C13H13NO3S and a molecular weight of 263.32 g/mol. Its IUPAC name is 3-[2-(4-ethoxyphenyl)-2-oxoethyl]-1,3-thiazol-2-one.
| Compound Name | 3-[2-(4-ethoxyphenyl)-2-oxoethyl]-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 63312406 |
| Molecular Formula | C13H13NO3S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 3-[2-(4-ethoxyphenyl)-2-oxoethyl]-1,3-thiazol-2-one |
| SMILES | CCOc1ccc(C(=O)Cn2ccsc2=O)cc1 |
| InChI | InChI=1S/C13H13NO3S/c1-2-17-11-5-3-10(4-6-11)12(15)9-14-7-8-18-13(14)16/h3-8H,2,9H2,1H3 |
| InChIKey | ZWPOQIDWHWZLKE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |