C14H13ClN2O4 — CID 66425954
5-chloro-1-[2-(4-ethoxyphenyl)-2-oxoethyl]pyrimidine-2,4-dione (PubChem CID 66425954) has the molecular formula C14H13ClN2O4 and a molecular weight of 308.72 g/mol. Its IUPAC name is 5-chloro-1-[2-(4-ethoxyphenyl)-2-oxoethyl]pyrimidine-2,4-dione.
| Compound Name | 5-chloro-1-[2-(4-ethoxyphenyl)-2-oxoethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 66425954 |
| Molecular Formula | C14H13ClN2O4 |
| Molecular Weight | 308.72 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 5-chloro-1-[2-(4-ethoxyphenyl)-2-oxoethyl]pyrimidine-2,4-dione |
| SMILES | CCOc1ccc(C(=O)Cn2cc(Cl)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C14H13ClN2O4/c1-2-21-10-5-3-9(4-6-10)12(18)8-17-7-11(15)13(19)16-14(17)20/h3-7H,2,8H2,1H3,(H,16,19,20) |
| InChIKey | UHZONMUQYHXMBA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.72 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |