C19H19NO3S — CID 100634280
4-[2-(4-butoxyphenyl)-2-oxoethyl]thieno[3,2-b]pyridin-7-one (PubChem CID 100634280) has the molecular formula C19H19NO3S and a molecular weight of 341.43 g/mol. Its IUPAC name is 4-[2-(4-butoxyphenyl)-2-oxoethyl]thieno[3,2-b]pyridin-7-one.
| Compound Name | 4-[2-(4-butoxyphenyl)-2-oxoethyl]thieno[3,2-b]pyridin-7-one |
|---|---|
| PubChem CID | 100634280 |
| Molecular Formula | C19H19NO3S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 4-[2-(4-butoxyphenyl)-2-oxoethyl]thieno[3,2-b]pyridin-7-one |
| SMILES | CCCCOc1ccc(C(=O)Cn2ccc(=O)c3sccc32)cc1 |
| InChI | InChI=1S/C19H19NO3S/c1-2-3-11-23-15-6-4-14(5-7-15)18(22)13-20-10-8-17(21)19-16(20)9-12-24-19/h4-10,12H,2-3,11,13H2,1H3 |
| InChIKey | OMAGJPNHSITAMR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|